C9H18FN3O — CID 129496379
2-[4-(2-fluoroethyl)piperidin-1-yl]-N'-hydroxyethanimidamide (PubChem CID 129496379) has the molecular formula C9H18FN3O and a molecular weight of 203.26 g/mol. Its IUPAC name is 2-[4-(2-fluoroethyl)piperidin-1-yl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[4-(2-fluoroethyl)piperidin-1-yl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 129496379 |
| Molecular Formula | C9H18FN3O |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 2-[4-(2-fluoroethyl)piperidin-1-yl]-N'-hydroxyethanimidamide |
| SMILES | NC(CN1CCC(CCF)CC1)=NO |
| InChI | InChI=1S/C9H18FN3O/c10-4-1-8-2-5-13(6-3-8)7-9(11)12-14/h8,14H,1-7H2,(H2,11,12) |
| InChIKey | JLVPPTUWLOLPBJ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|