C12H17ClN4O2S — CID 80641295
N-[1-[(2E)-2-amino-2-hydroxyiminoethyl]piperidin-4-yl]-3-chlorothiophene-2-carboxamide (PubChem CID 80641295) has the molecular formula C12H17ClN4O2S and a molecular weight of 316.81 g/mol. Its IUPAC name is N-[1-[(2E)-2-amino-2-hydroxyiminoethyl]piperidin-4-yl]-3-chlorothiophene-2-carboxamide.
| Compound Name | N-[1-[(2E)-2-amino-2-hydroxyiminoethyl]piperidin-4-yl]-3-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 80641295 |
| Molecular Formula | C12H17ClN4O2S |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | N-[1-[(2E)-2-amino-2-hydroxyiminoethyl]piperidin-4-yl]-3-chlorothiophene-2-carboxamide |
| SMILES | N/C(CN1CCC(NC(=O)c2sccc2Cl)CC1)=N/O |
| InChI | InChI=1S/C12H17ClN4O2S/c13-9-3-6-20-11(9)12(18)15-8-1-4-17(5-2-8)7-10(14)16-19/h3,6,8,19H,1-2,4-5,7H2,(H2,14,16)(H,15,18) |
| InChIKey | NKDHFYNVRSVXBT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|