C8H18N4O2S2 — CID 114808399
2-[4-(methylsulfamoylamino)piperidin-1-yl]ethanethioamide (PubChem CID 114808399) has the molecular formula C8H18N4O2S2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 2-[4-(methylsulfamoylamino)piperidin-1-yl]ethanethioamide.
| Compound Name | 2-[4-(methylsulfamoylamino)piperidin-1-yl]ethanethioamide |
|---|---|
| PubChem CID | 114808399 |
| Molecular Formula | C8H18N4O2S2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2-[4-(methylsulfamoylamino)piperidin-1-yl]ethanethioamide |
| SMILES | CNS(=O)(=O)NC1CCN(CC(N)=S)CC1 |
| InChI | InChI=1S/C8H18N4O2S2/c1-10-16(13,14)11-7-2-4-12(5-3-7)6-8(9)15/h7,10-11H,2-6H2,1H3,(H2,9,15) |
| InChIKey | YNFHYUVNAKFADZ-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|