C14H28N4O4S — CID 139004941
N-(2-methyl-4-oxopentan-3-yl)-2-[4-(methylsulfamoylamino)piperidin-1-yl]acetamide (PubChem CID 139004941) has the molecular formula C14H28N4O4S and a molecular weight of 348.47 g/mol. Its IUPAC name is N-(2-methyl-4-oxopentan-3-yl)-2-[4-(methylsulfamoylamino)piperidin-1-yl]acetamide.
| Compound Name | N-(2-methyl-4-oxopentan-3-yl)-2-[4-(methylsulfamoylamino)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 139004941 |
| Molecular Formula | C14H28N4O4S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | N-(2-methyl-4-oxopentan-3-yl)-2-[4-(methylsulfamoylamino)piperidin-1-yl]acetamide |
| SMILES | CNS(=O)(=O)NC1CCN(CC(=O)NC(C(C)=O)C(C)C)CC1 |
| InChI | InChI=1S/C14H28N4O4S/c1-10(2)14(11(3)19)16-13(20)9-18-7-5-12(6-8-18)17-23(21,22)15-4/h10,12,14-15,17H,5-9H2,1-4H3,(H,16,20) |
| InChIKey | ZVSRCGIJUVSRAM-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |