C12H21N5O2S2 — CID 63625246
2-[4-[(1,2-dimethylimidazol-4-yl)sulfonylamino]piperidin-1-yl]ethanethioamide (PubChem CID 63625246) has the molecular formula C12H21N5O2S2 and a molecular weight of 331.47 g/mol. Its IUPAC name is 2-[4-[(1,2-dimethylimidazol-4-yl)sulfonylamino]piperidin-1-yl]ethanethioamide.
| Compound Name | 2-[4-[(1,2-dimethylimidazol-4-yl)sulfonylamino]piperidin-1-yl]ethanethioamide |
|---|---|
| PubChem CID | 63625246 |
| Molecular Formula | C12H21N5O2S2 |
| Molecular Weight | 331.47 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 2-[4-[(1,2-dimethylimidazol-4-yl)sulfonylamino]piperidin-1-yl]ethanethioamide |
| SMILES | Cc1nc(S(=O)(=O)NC2CCN(CC(N)=S)CC2)cn1C |
| InChI | InChI=1S/C12H21N5O2S2/c1-9-14-12(8-16(9)2)21(18,19)15-10-3-5-17(6-4-10)7-11(13)20/h8,10,15H,3-7H2,1-2H3,(H2,13,20) |
| InChIKey | NCHOTHDFALXDQD-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.47 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|