C14H24N4O5S — CID 59142688
(1S,5R)-2-[(1-methylazocan-4-yl)carbamoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid (PubChem CID 59142688) has the molecular formula C14H24N4O5S and a molecular weight of 360.44 g/mol. Its IUPAC name is (1S,5R)-2-[(1-methylazocan-4-yl)carbamoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid.
| Compound Name | (1S,5R)-2-[(1-methylazocan-4-yl)carbamoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid |
|---|---|
| PubChem CID | 59142688 |
| Molecular Formula | C14H24N4O5S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | (1S,5R)-2-[(1-methylazocan-4-yl)carbamoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid |
| SMILES | CN1CCCCC(NC(=O)N2CC[C@@H]3[C@H]2C(=O)N3S(=O)(=O)O)CC1 |
| InChI | InChI=1S/C14H24N4O5S/c1-16-7-3-2-4-10(5-8-16)15-14(20)17-9-6-11-12(17)13(19)18(11)24(21,22)23/h10-12H,2-9H2,1H3,(H,15,20)(H,21,22,23)/t10?,11-,12+/m1/s1 |
| InChIKey | ZGAPEABXOCZUAJ-SAIIYOCFSA-N |
| XLogP | -0.34 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|