C13H21N5O5S — CID 89276637
(1S)-2-[[(4S)-1-methanimidoylazepan-4-yl]carbamoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid (PubChem CID 89276637) has the molecular formula C13H21N5O5S and a molecular weight of 359.41 g/mol. Its IUPAC name is (1S)-2-[[(4S)-1-methanimidoylazepan-4-yl]carbamoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid.
| Compound Name | (1S)-2-[[(4S)-1-methanimidoylazepan-4-yl]carbamoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid |
|---|---|
| PubChem CID | 89276637 |
| Molecular Formula | C13H21N5O5S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | (1S)-2-[[(4S)-1-methanimidoylazepan-4-yl]carbamoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid |
| SMILES | [H]/N=C/N1CCC[C@H](NC(=O)N2CCC3[C@H]2C(=O)N3S(=O)(=O)O)CC1 |
| InChI | InChI=1S/C13H21N5O5S/c14-8-16-5-1-2-9(3-6-16)15-13(20)17-7-4-10-11(17)12(19)18(10)24(21,22)23/h8-11,14H,1-7H2,(H,15,20)(H,21,22,23)/b14-8+/t9-,10?,11-/m0/s1 |
| InChIKey | CMRWPVPVLHVZEX-AMXVTBQNSA-N |
| XLogP | -0.75 |
| TPSA | 134.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|