C10H19N3O3S — CID 155942451
2-[3-(cyclopropylsulfonylamino)piperidin-1-yl]acetamide (PubChem CID 155942451) has the molecular formula C10H19N3O3S and a molecular weight of 261.35 g/mol. Its IUPAC name is 2-[3-(cyclopropylsulfonylamino)piperidin-1-yl]acetamide.
| Compound Name | 2-[3-(cyclopropylsulfonylamino)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 155942451 |
| Molecular Formula | C10H19N3O3S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2-[3-(cyclopropylsulfonylamino)piperidin-1-yl]acetamide |
| SMILES | NC(=O)CN1CCCC(NS(=O)(=O)C2CC2)C1 |
| InChI | InChI=1S/C10H19N3O3S/c11-10(14)7-13-5-1-2-8(6-13)12-17(15,16)9-3-4-9/h8-9,12H,1-7H2,(H2,11,14) |
| InChIKey | ARAIVJKLAUISFJ-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |