C16H29N3O3S — CID 163344856
N-cyclohexyl-2-[3-(cyclopropylsulfonylamino)piperidin-1-yl]acetamide (PubChem CID 163344856) has the molecular formula C16H29N3O3S and a molecular weight of 343.49 g/mol. Its IUPAC name is N-cyclohexyl-2-[3-(cyclopropylsulfonylamino)piperidin-1-yl]acetamide.
| Compound Name | N-cyclohexyl-2-[3-(cyclopropylsulfonylamino)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 163344856 |
| Molecular Formula | C16H29N3O3S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-cyclohexyl-2-[3-(cyclopropylsulfonylamino)piperidin-1-yl]acetamide |
| SMILES | O=C(CN1CCCC(NS(=O)(=O)C2CC2)C1)NC1CCCCC1 |
| InChI | InChI=1S/C16H29N3O3S/c20-16(17-13-5-2-1-3-6-13)12-19-10-4-7-14(11-19)18-23(21,22)15-8-9-15/h13-15,18H,1-12H2,(H,17,20) |
| InChIKey | BFWATENELICBER-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |