C14H25N3O3S — CID 163345230
N-cyclopropyl-2-[3-[cyclopropylsulfonyl(methyl)amino]piperidin-1-yl]acetamide (PubChem CID 163345230) has the molecular formula C14H25N3O3S and a molecular weight of 315.44 g/mol. Its IUPAC name is N-cyclopropyl-2-[3-[cyclopropylsulfonyl(methyl)amino]piperidin-1-yl]acetamide.
| Compound Name | N-cyclopropyl-2-[3-[cyclopropylsulfonyl(methyl)amino]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 163345230 |
| Molecular Formula | C14H25N3O3S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-cyclopropyl-2-[3-[cyclopropylsulfonyl(methyl)amino]piperidin-1-yl]acetamide |
| SMILES | CN(C1CCCN(CC(=O)NC2CC2)C1)S(=O)(=O)C1CC1 |
| InChI | InChI=1S/C14H25N3O3S/c1-16(21(19,20)13-6-7-13)12-3-2-8-17(9-12)10-14(18)15-11-4-5-11/h11-13H,2-10H2,1H3,(H,15,18) |
| InChIKey | FNYADIHVBFSAHG-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |