C15H29N3O3S — CID 163345199
N-tert-butyl-2-[3-[cyclopropylsulfonyl(methyl)amino]piperidin-1-yl]acetamide (PubChem CID 163345199) has the molecular formula C15H29N3O3S and a molecular weight of 331.48 g/mol. Its IUPAC name is N-tert-butyl-2-[3-[cyclopropylsulfonyl(methyl)amino]piperidin-1-yl]acetamide.
| Compound Name | N-tert-butyl-2-[3-[cyclopropylsulfonyl(methyl)amino]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 163345199 |
| Molecular Formula | C15H29N3O3S |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | N-tert-butyl-2-[3-[cyclopropylsulfonyl(methyl)amino]piperidin-1-yl]acetamide |
| SMILES | CN(C1CCCN(CC(=O)NC(C)(C)C)C1)S(=O)(=O)C1CC1 |
| InChI | InChI=1S/C15H29N3O3S/c1-15(2,3)16-14(19)11-18-9-5-6-12(10-18)17(4)22(20,21)13-7-8-13/h12-13H,5-11H2,1-4H3,(H,16,19) |
| InChIKey | QKNNFPAIDQVONJ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |