C15H19FN2O5S — CID 168713501
tert-butyl N-[4-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)phenyl]carbamate (PubChem CID 168713501) has the molecular formula C15H19FN2O5S and a molecular weight of 358.39 g/mol. Its IUPAC name is tert-butyl N-[4-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 168713501 |
| Molecular Formula | C15H19FN2O5S |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | tert-butyl N-[4-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(N2CC(S(=O)(=O)F)CC2=O)cc1 |
| InChI | InChI=1S/C15H19FN2O5S/c1-15(2,3)23-14(20)17-10-4-6-11(7-5-10)18-9-12(8-13(18)19)24(16,21)22/h4-7,12H,8-9H2,1-3H3,(H,17,20) |
| InChIKey | YKDOSUDOPFYAFA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |