C14H18FN3O4S — CID 168713846
1-[4-[[2-(dimethylamino)acetyl]amino]phenyl]-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168713846) has the molecular formula C14H18FN3O4S and a molecular weight of 343.38 g/mol. Its IUPAC name is 1-[4-[[2-(dimethylamino)acetyl]amino]phenyl]-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-[4-[[2-(dimethylamino)acetyl]amino]phenyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168713846 |
| Molecular Formula | C14H18FN3O4S |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 1-[4-[[2-(dimethylamino)acetyl]amino]phenyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | CN(C)CC(=O)Nc1ccc(N2CC(S(=O)(=O)F)CC2=O)cc1 |
| InChI | InChI=1S/C14H18FN3O4S/c1-17(2)9-13(19)16-10-3-5-11(6-4-10)18-8-12(7-14(18)20)23(15,21)22/h3-6,12H,7-9H2,1-2H3,(H,16,19) |
| InChIKey | LCBGABUDMJPJRA-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |