C13H15FN2O4S — CID 168713630
1-(3-acetamido-4-methylphenyl)-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168713630) has the molecular formula C13H15FN2O4S and a molecular weight of 314.34 g/mol. Its IUPAC name is 1-(3-acetamido-4-methylphenyl)-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-(3-acetamido-4-methylphenyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168713630 |
| Molecular Formula | C13H15FN2O4S |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 1-(3-acetamido-4-methylphenyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | CC(=O)Nc1cc(N2CC(S(=O)(=O)F)CC2=O)ccc1C |
| InChI | InChI=1S/C13H15FN2O4S/c1-8-3-4-10(5-12(8)15-9(2)17)16-7-11(6-13(16)18)21(14,19)20/h3-5,11H,6-7H2,1-2H3,(H,15,17) |
| InChIKey | YQEUKHHGRWOEAW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |