C14H16FNO5S — CID 168715999
4-[4-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)phenyl]butanoic acid (PubChem CID 168715999) has the molecular formula C14H16FNO5S and a molecular weight of 329.35 g/mol. Its IUPAC name is 4-[4-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)phenyl]butanoic acid.
| Compound Name | 4-[4-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 168715999 |
| Molecular Formula | C14H16FNO5S |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 4-[4-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)phenyl]butanoic acid |
| SMILES | O=C(O)CCCc1ccc(N2CC(S(=O)(=O)F)CC2=O)cc1 |
| InChI | InChI=1S/C14H16FNO5S/c15-22(20,21)12-8-13(17)16(9-12)11-6-4-10(5-7-11)2-1-3-14(18)19/h4-7,12H,1-3,8-9H2,(H,18,19) |
| InChIKey | VLRQKMRKAHDCFP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |