C17H22N4O5S — CID 67121301
(1S,5R)-7-oxo-2-[(2-piperidin-4-ylphenyl)carbamoyl]-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid (PubChem CID 67121301) has the molecular formula C17H22N4O5S and a molecular weight of 394.45 g/mol. Its IUPAC name is (1S,5R)-7-oxo-2-[(2-piperidin-4-ylphenyl)carbamoyl]-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid.
| Compound Name | (1S,5R)-7-oxo-2-[(2-piperidin-4-ylphenyl)carbamoyl]-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid |
|---|---|
| PubChem CID | 67121301 |
| Molecular Formula | C17H22N4O5S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | (1S,5R)-7-oxo-2-[(2-piperidin-4-ylphenyl)carbamoyl]-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid |
| SMILES | O=C(Nc1ccccc1C1CCNCC1)N1CC[C@@H]2[C@H]1C(=O)N2S(=O)(=O)O |
| InChI | InChI=1S/C17H22N4O5S/c22-16-15-14(21(16)27(24,25)26)7-10-20(15)17(23)19-13-4-2-1-3-12(13)11-5-8-18-9-6-11/h1-4,11,14-15,18H,5-10H2,(H,19,23)(H,24,25,26)/t14-,15+/m1/s1 |
| InChIKey | BWJUCNANZUTLEY-CABCVRRESA-N |
| XLogP | 0.77 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|