C14H16N3O7S+ — CID 87277035
(1S,5R)-2-[2-(3-methoxycarbonylpyridin-1-ium-1-yl)acetyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid (PubChem CID 87277035) has the molecular formula C14H16N3O7S+ and a molecular weight of 370.36 g/mol. Its IUPAC name is (1S,5R)-2-[2-(3-methoxycarbonylpyridin-1-ium-1-yl)acetyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid.
| Compound Name | (1S,5R)-2-[2-(3-methoxycarbonylpyridin-1-ium-1-yl)acetyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid |
|---|---|
| PubChem CID | 87277035 |
| Molecular Formula | C14H16N3O7S+ |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | (1S,5R)-2-[2-(3-methoxycarbonylpyridin-1-ium-1-yl)acetyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid |
| SMILES | COC(=O)c1ccc[n+](CC(=O)N2CC[C@@H]3[C@H]2C(=O)N3S(=O)(=O)O)c1 |
| InChI | InChI=1S/C14H15N3O7S/c1-24-14(20)9-3-2-5-15(7-9)8-11(18)16-6-4-10-12(16)13(19)17(10)25(21,22)23/h2-3,5,7,10,12H,4,6,8H2,1H3/p+1/t10-,12+/m1/s1 |
| InChIKey | JKSWOJSZQNUORH-PWSUYJOCSA-O |
| XLogP | -1.62 |
| TPSA | 125.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|