C14H21N4O2+ — CID 21354804
N'-methyl-1-[2-(2-methylpyrrolidin-1-yl)-2-oxoethyl]pyridin-1-ium-3-carbohydrazide (PubChem CID 21354804) has the molecular formula C14H21N4O2+ and a molecular weight of 277.35 g/mol. Its IUPAC name is N'-methyl-1-[2-(2-methylpyrrolidin-1-yl)-2-oxoethyl]pyridin-1-ium-3-carbohydrazide.
| Compound Name | N'-methyl-1-[2-(2-methylpyrrolidin-1-yl)-2-oxoethyl]pyridin-1-ium-3-carbohydrazide |
|---|---|
| PubChem CID | 21354804 |
| Molecular Formula | C14H21N4O2+ |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | N'-methyl-1-[2-(2-methylpyrrolidin-1-yl)-2-oxoethyl]pyridin-1-ium-3-carbohydrazide |
| SMILES | CNNC(=O)c1ccc[n+](CC(=O)N2CCCC2C)c1 |
| InChI | InChI=1S/C14H20N4O2/c1-11-5-3-8-18(11)13(19)10-17-7-4-6-12(9-17)14(20)16-15-2/h4,6-7,9,11,15H,3,5,8,10H2,1-2H3/p+1 |
| InChIKey | ASIUMORZZPNZQD-UHFFFAOYSA-O |
| XLogP | -0.15 |
| TPSA | 65.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|