C14H18ClN3O2 — CID 168988063
4-amino-3-chloro-N-[2-[(2R)-2-methylpyrrolidin-1-yl]-2-oxoethyl]benzamide (PubChem CID 168988063) has the molecular formula C14H18ClN3O2 and a molecular weight of 295.77 g/mol. Its IUPAC name is 4-amino-3-chloro-N-[2-[(2R)-2-methylpyrrolidin-1-yl]-2-oxoethyl]benzamide.
| Compound Name | 4-amino-3-chloro-N-[2-[(2R)-2-methylpyrrolidin-1-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 168988063 |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 4-amino-3-chloro-N-[2-[(2R)-2-methylpyrrolidin-1-yl]-2-oxoethyl]benzamide |
| SMILES | C[C@@H]1CCCN1C(=O)CNC(=O)c1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C14H18ClN3O2/c1-9-3-2-6-18(9)13(19)8-17-14(20)10-4-5-12(16)11(15)7-10/h4-5,7,9H,2-3,6,8,16H2,1H3,(H,17,20)/t9-/m1/s1 |
| InChIKey | NWINKCHBOWUQGF-SECBINFHSA-N |
| XLogP | 1.66 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|