C17H23N2O3+ — CID 143578490
ethane;methyl 1-[2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-2-oxoethyl]pyridin-1-ium-3-carboxylate (PubChem CID 143578490) has the molecular formula C17H23N2O3+ and a molecular weight of 303.38 g/mol. Its IUPAC name is ethane;methyl 1-[2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-2-oxoethyl]pyridin-1-ium-3-carboxylate.
| Compound Name | ethane;methyl 1-[2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-2-oxoethyl]pyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 143578490 |
| Molecular Formula | C17H23N2O3+ |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | ethane;methyl 1-[2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-2-oxoethyl]pyridin-1-ium-3-carboxylate |
| SMILES | C=C/C=C(\C=C)NC(=O)C[n+]1cccc(C(=O)OC)c1.CC |
| InChI | InChI=1S/C15H16N2O3.C2H6/c1-4-7-13(5-2)16-14(18)11-17-9-6-8-12(10-17)15(19)20-3;1-2/h4-10H,1-2,11H2,3H3;1-2H3/p+1/b13-7+; |
| InChIKey | FKZLJZGNQITVTA-FTPOTTDRSA-O |
| XLogP | 2.16 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|