C14H16N2O2 — CID 143870185
3-amino-N-[(3E)-hexa-1,3,5-trien-3-yl]-4-methoxybenzamide (PubChem CID 143870185) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 3-amino-N-[(3E)-hexa-1,3,5-trien-3-yl]-4-methoxybenzamide.
| Compound Name | 3-amino-N-[(3E)-hexa-1,3,5-trien-3-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 143870185 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 3-amino-N-[(3E)-hexa-1,3,5-trien-3-yl]-4-methoxybenzamide |
| SMILES | C=C/C=C(\C=C)NC(=O)c1ccc(OC)c(N)c1 |
| InChI | InChI=1S/C14H16N2O2/c1-4-6-11(5-2)16-14(17)10-7-8-13(18-3)12(15)9-10/h4-9H,1-2,15H2,3H3,(H,16,17)/b11-6+ |
| InChIKey | SNKRIWVEQFJKLL-IZZDOVSWSA-N |
| XLogP | 2.26 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|