C14H14N6O5S2 — CID 22880220
(1S,5R)-7-oxo-2-[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid (PubChem CID 22880220) has the molecular formula C14H14N6O5S2 and a molecular weight of 410.44 g/mol. Its IUPAC name is (1S,5R)-7-oxo-2-[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid.
| Compound Name | (1S,5R)-7-oxo-2-[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid |
|---|---|
| PubChem CID | 22880220 |
| Molecular Formula | C14H14N6O5S2 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | (1S,5R)-7-oxo-2-[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid |
| SMILES | O=C(CSc1nnnn1-c1ccccc1)N1CC[C@@H]2[C@H]1C(=O)N2S(=O)(=O)O |
| InChI | InChI=1S/C14H14N6O5S2/c21-11(18-7-6-10-12(18)13(22)20(10)27(23,24)25)8-26-14-15-16-17-19(14)9-4-2-1-3-5-9/h1-5,10,12H,6-8H2,(H,23,24,25)/t10-,12+/m1/s1 |
| InChIKey | MBZFQYDUUJEOOS-PWSUYJOCSA-N |
| XLogP | -0.63 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|