C19H22N4OS — CID 2974219
1-(1-adamantyl)-2-(1-phenyltetrazol-5-yl)sulfanylethanone (PubChem CID 2974219) has the molecular formula C19H22N4OS and a molecular weight of 354.48 g/mol. Its IUPAC name is 1-(1-adamantyl)-2-(1-phenyltetrazol-5-yl)sulfanylethanone.
| Compound Name | 1-(1-adamantyl)-2-(1-phenyltetrazol-5-yl)sulfanylethanone |
|---|---|
| PubChem CID | 2974219 |
| Molecular Formula | C19H22N4OS |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 1-(1-adamantyl)-2-(1-phenyltetrazol-5-yl)sulfanylethanone |
| SMILES | O=C(CSc1nnnn1-c1ccccc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H22N4OS/c24-17(19-9-13-6-14(10-19)8-15(7-13)11-19)12-25-18-20-21-22-23(18)16-4-2-1-3-5-16/h1-5,13-15H,6-12H2 |
| InChIKey | LVCQOUDQSXHZQU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |