C20H24ClN5OS — CID 8860480
N-(1-adamantylmethyl)-2-[1-(3-chlorophenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 8860480) has the molecular formula C20H24ClN5OS and a molecular weight of 417.97 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-[1-(3-chlorophenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(1-adamantylmethyl)-2-[1-(3-chlorophenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 8860480 |
| Molecular Formula | C20H24ClN5OS |
| Molecular Weight | 417.97 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | N-(1-adamantylmethyl)-2-[1-(3-chlorophenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1-c1cccc(Cl)c1)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H24ClN5OS/c21-16-2-1-3-17(7-16)26-19(23-24-25-26)28-11-18(27)22-12-20-8-13-4-14(9-20)6-15(5-13)10-20/h1-3,7,13-15H,4-6,8-12H2,(H,22,27) |
| InChIKey | ACFMIYCGRBSDHM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.97 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |