C12H16N2O4S — CID 97402486
[(3aS,6aS)-5-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(furan-2-yl)methanone (PubChem CID 97402486) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is [(3aS,6aS)-5-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(furan-2-yl)methanone.
| Compound Name | [(3aS,6aS)-5-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 97402486 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | [(3aS,6aS)-5-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(furan-2-yl)methanone |
| SMILES | CS(=O)(=O)N1C[C@@H]2CCN(C(=O)c3ccco3)[C@@H]2C1 |
| InChI | InChI=1S/C12H16N2O4S/c1-19(16,17)13-7-9-4-5-14(10(9)8-13)12(15)11-3-2-6-18-11/h2-3,6,9-10H,4-5,7-8H2,1H3/t9-,10+/m0/s1 |
| InChIKey | WCRJTTPRKGWWIH-VHSXEESVSA-N |
| XLogP | 0.39 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |