C15H21N3O3S — CID 131686897
[(3aS,6aS)-5-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(6-ethyl-3-pyridinyl)methanone (PubChem CID 131686897) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is [(3aS,6aS)-5-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(6-ethyl-3-pyridinyl)methanone.
| Compound Name | [(3aS,6aS)-5-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(6-ethyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 131686897 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | [(3aS,6aS)-5-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(6-ethyl-3-pyridinyl)methanone |
| SMILES | CCc1ccc(C(=O)N2CC[C@H]3CN(S(C)(=O)=O)C[C@H]32)cn1 |
| InChI | InChI=1S/C15H21N3O3S/c1-3-13-5-4-11(8-16-13)15(19)18-7-6-12-9-17(10-14(12)18)22(2,20)21/h4-5,8,12,14H,3,6-7,9-10H2,1-2H3/t12-,14+/m0/s1 |
| InChIKey | RUKRLHNTZJJZNV-GXTWGEPZSA-N |
| XLogP | 0.75 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |