C20H30N4O3S — CID 110264450
1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-[6-(1-methylsulfonylpiperidin-4-yl)-3-pyridinyl]methanone (PubChem CID 110264450) has the molecular formula C20H30N4O3S and a molecular weight of 406.55 g/mol. Its IUPAC name is 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-[6-(1-methylsulfonylpiperidin-4-yl)-3-pyridinyl]methanone.
| Compound Name | 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-[6-(1-methylsulfonylpiperidin-4-yl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 110264450 |
| Molecular Formula | C20H30N4O3S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-[6-(1-methylsulfonylpiperidin-4-yl)-3-pyridinyl]methanone |
| SMILES | CS(=O)(=O)N1CCC(c2ccc(C(=O)N3CCN4CCCCC4C3)cn2)CC1 |
| InChI | InChI=1S/C20H30N4O3S/c1-28(26,27)24-10-7-16(8-11-24)19-6-5-17(14-21-19)20(25)23-13-12-22-9-3-2-4-18(22)15-23/h5-6,14,16,18H,2-4,7-13,15H2,1H3 |
| InChIKey | JGYKVHIXWPXKMH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |