C22H28N2O3 — CID 131697305
[(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-(6-ethyl-3-pyridinyl)methanone (PubChem CID 131697305) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is [(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-(6-ethyl-3-pyridinyl)methanone.
| Compound Name | [(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-(6-ethyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 131697305 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | [(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-(6-ethyl-3-pyridinyl)methanone |
| SMILES | CCc1ccc(C(=O)N2CC[C@@H](OCCOC)[C@@H]2Cc2ccccc2)cn1 |
| InChI | InChI=1S/C22H28N2O3/c1-3-19-10-9-18(16-23-19)22(25)24-12-11-21(27-14-13-26-2)20(24)15-17-7-5-4-6-8-17/h4-10,16,20-21H,3,11-15H2,1-2H3/t20-,21+/m0/s1 |
| InChIKey | YZDAPVJDKSCJJI-LEWJYISDSA-N |
| XLogP | 3.13 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|