C19H23NO4 — CID 97470143
[(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-(furan-3-yl)methanone (PubChem CID 97470143) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is [(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-(furan-3-yl)methanone.
| Compound Name | [(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-(furan-3-yl)methanone |
|---|---|
| PubChem CID | 97470143 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | [(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-(furan-3-yl)methanone |
| SMILES | COCCO[C@@H]1CCN(C(=O)c2ccoc2)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C19H23NO4/c1-22-11-12-24-18-7-9-20(19(21)16-8-10-23-14-16)17(18)13-15-5-3-2-4-6-15/h2-6,8,10,14,17-18H,7,9,11-13H2,1H3/t17-,18+/m0/s1 |
| InChIKey | MLMTUSUMGQVVCK-ZWKOTPCHSA-N |
| XLogP | 2.77 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|