C19H22N2O2 — CID 131683149
[(2S,3R)-2-benzyl-3-prop-2-enoxypyrrolidin-1-yl]-(1H-pyrrol-3-yl)methanone (PubChem CID 131683149) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is [(2S,3R)-2-benzyl-3-prop-2-enoxypyrrolidin-1-yl]-(1H-pyrrol-3-yl)methanone.
| Compound Name | [(2S,3R)-2-benzyl-3-prop-2-enoxypyrrolidin-1-yl]-(1H-pyrrol-3-yl)methanone |
|---|---|
| PubChem CID | 131683149 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | [(2S,3R)-2-benzyl-3-prop-2-enoxypyrrolidin-1-yl]-(1H-pyrrol-3-yl)methanone |
| SMILES | C=CCO[C@@H]1CCN(C(=O)c2cc[nH]c2)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C19H22N2O2/c1-2-12-23-18-9-11-21(19(22)16-8-10-20-14-16)17(18)13-15-6-4-3-5-7-15/h2-8,10,14,17-18,20H,1,9,11-13H2/t17-,18+/m0/s1 |
| InChIKey | RNLDIZVSVFHYOY-ZWKOTPCHSA-N |
| XLogP | 3.04 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|