C20H27NO3 — CID 131683289
1-[(2S,3R)-2-benzyl-3-prop-2-enoxypyrrolidin-1-yl]-2-(1-hydroxycyclobutyl)ethanone (PubChem CID 131683289) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is 1-[(2S,3R)-2-benzyl-3-prop-2-enoxypyrrolidin-1-yl]-2-(1-hydroxycyclobutyl)ethanone.
| Compound Name | 1-[(2S,3R)-2-benzyl-3-prop-2-enoxypyrrolidin-1-yl]-2-(1-hydroxycyclobutyl)ethanone |
|---|---|
| PubChem CID | 131683289 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 1-[(2S,3R)-2-benzyl-3-prop-2-enoxypyrrolidin-1-yl]-2-(1-hydroxycyclobutyl)ethanone |
| SMILES | C=CCO[C@@H]1CCN(C(=O)CC2(O)CCC2)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C20H27NO3/c1-2-13-24-18-9-12-21(19(22)15-20(23)10-6-11-20)17(18)14-16-7-4-3-5-8-16/h2-5,7-8,17-18,23H,1,6,9-15H2/t17-,18+/m0/s1 |
| InChIKey | XVZJDBNDSICVGZ-ZWKOTPCHSA-N |
| XLogP | 2.71 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|