C20H23N3O2 — CID 97391894
(6-methyl-3-pyridinyl)-[(2S,3R)-3-prop-2-enoxy-2-(pyridin-3-ylmethyl)pyrrolidin-1-yl]methanone (PubChem CID 97391894) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is (6-methyl-3-pyridinyl)-[(2S,3R)-3-prop-2-enoxy-2-(pyridin-3-ylmethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (6-methyl-3-pyridinyl)-[(2S,3R)-3-prop-2-enoxy-2-(pyridin-3-ylmethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 97391894 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | (6-methyl-3-pyridinyl)-[(2S,3R)-3-prop-2-enoxy-2-(pyridin-3-ylmethyl)pyrrolidin-1-yl]methanone |
| SMILES | C=CCO[C@@H]1CCN(C(=O)c2ccc(C)nc2)[C@H]1Cc1cccnc1 |
| InChI | InChI=1S/C20H23N3O2/c1-3-11-25-19-8-10-23(18(19)12-16-5-4-9-21-13-16)20(24)17-7-6-15(2)22-14-17/h3-7,9,13-14,18-19H,1,8,10-12H2,2H3/t18-,19+/m0/s1 |
| InChIKey | ZXBBBUANFYPQAI-RBUKOAKNSA-N |
| XLogP | 2.81 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|