C18H22N4O2 — CID 124820889
[(2R,3R)-2-[(1-methylpyrazol-4-yl)methyl]-3-prop-2-enoxypyrrolidin-1-yl]-pyridin-3-ylmethanone (PubChem CID 124820889) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is [(2R,3R)-2-[(1-methylpyrazol-4-yl)methyl]-3-prop-2-enoxypyrrolidin-1-yl]-pyridin-3-ylmethanone.
| Compound Name | [(2R,3R)-2-[(1-methylpyrazol-4-yl)methyl]-3-prop-2-enoxypyrrolidin-1-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 124820889 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | [(2R,3R)-2-[(1-methylpyrazol-4-yl)methyl]-3-prop-2-enoxypyrrolidin-1-yl]-pyridin-3-ylmethanone |
| SMILES | C=CCO[C@@H]1CCN(C(=O)c2cccnc2)[C@@H]1Cc1cnn(C)c1 |
| InChI | InChI=1S/C18H22N4O2/c1-3-9-24-17-6-8-22(18(23)15-5-4-7-19-12-15)16(17)10-14-11-20-21(2)13-14/h3-5,7,11-13,16-17H,1,6,8-10H2,2H3/t16-,17-/m1/s1 |
| InChIKey | VIJAWTNWHNVUON-IAGOWNOFSA-N |
| XLogP | 1.84 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|