C19H24N4O2 — CID 124822095
[(2R,3R)-2-[(1-methylpyrazol-4-yl)methyl]-3-prop-2-enoxypyrrolidin-1-yl]-(5-methyl-3-pyridinyl)methanone (PubChem CID 124822095) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is [(2R,3R)-2-[(1-methylpyrazol-4-yl)methyl]-3-prop-2-enoxypyrrolidin-1-yl]-(5-methyl-3-pyridinyl)methanone.
| Compound Name | [(2R,3R)-2-[(1-methylpyrazol-4-yl)methyl]-3-prop-2-enoxypyrrolidin-1-yl]-(5-methyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 124822095 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | [(2R,3R)-2-[(1-methylpyrazol-4-yl)methyl]-3-prop-2-enoxypyrrolidin-1-yl]-(5-methyl-3-pyridinyl)methanone |
| SMILES | C=CCO[C@@H]1CCN(C(=O)c2cncc(C)c2)[C@@H]1Cc1cnn(C)c1 |
| InChI | InChI=1S/C19H24N4O2/c1-4-7-25-18-5-6-23(17(18)9-15-11-21-22(3)13-15)19(24)16-8-14(2)10-20-12-16/h4,8,10-13,17-18H,1,5-7,9H2,2-3H3/t17-,18-/m1/s1 |
| InChIKey | ZQWUEZPDFITOFM-QZTJIDSGSA-N |
| XLogP | 2.15 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|