C20H24N2O3 — CID 124809911
(2,5-dimethylfuran-3-yl)-[(2R,3R)-3-prop-2-enoxy-2-(pyridin-3-ylmethyl)pyrrolidin-1-yl]methanone (PubChem CID 124809911) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is (2,5-dimethylfuran-3-yl)-[(2R,3R)-3-prop-2-enoxy-2-(pyridin-3-ylmethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (2,5-dimethylfuran-3-yl)-[(2R,3R)-3-prop-2-enoxy-2-(pyridin-3-ylmethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 124809911 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | (2,5-dimethylfuran-3-yl)-[(2R,3R)-3-prop-2-enoxy-2-(pyridin-3-ylmethyl)pyrrolidin-1-yl]methanone |
| SMILES | C=CCO[C@@H]1CCN(C(=O)c2cc(C)oc2C)[C@@H]1Cc1cccnc1 |
| InChI | InChI=1S/C20H24N2O3/c1-4-10-24-19-7-9-22(18(19)12-16-6-5-8-21-13-16)20(23)17-11-14(2)25-15(17)3/h4-6,8,11,13,18-19H,1,7,9-10,12H2,2-3H3/t18-,19-/m1/s1 |
| InChIKey | QESYQPGJUNWBFM-RTBURBONSA-N |
| XLogP | 3.32 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|