C16H22N2O3 — CID 124789186
2-methoxy-1-[(2R,3R)-3-prop-2-enoxy-2-(pyridin-4-ylmethyl)pyrrolidin-1-yl]ethanone (PubChem CID 124789186) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-methoxy-1-[(2R,3R)-3-prop-2-enoxy-2-(pyridin-4-ylmethyl)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-methoxy-1-[(2R,3R)-3-prop-2-enoxy-2-(pyridin-4-ylmethyl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 124789186 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 2-methoxy-1-[(2R,3R)-3-prop-2-enoxy-2-(pyridin-4-ylmethyl)pyrrolidin-1-yl]ethanone |
| SMILES | C=CCO[C@@H]1CCN(C(=O)COC)[C@@H]1Cc1ccncc1 |
| InChI | InChI=1S/C16H22N2O3/c1-3-10-21-15-6-9-18(16(19)12-20-2)14(15)11-13-4-7-17-8-5-13/h3-5,7-8,14-15H,1,6,9-12H2,2H3/t14-,15-/m1/s1 |
| InChIKey | HNAJGSOPZPXGKL-HUUCEWRRSA-N |
| XLogP | 1.44 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|