C18H23N3O3 — CID 133141846
[(2R,3R)-3-(2-methoxyethoxy)-2-(pyridin-4-ylmethyl)pyrrolidin-1-yl]-(1H-pyrrol-2-yl)methanone (PubChem CID 133141846) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is [(2R,3R)-3-(2-methoxyethoxy)-2-(pyridin-4-ylmethyl)pyrrolidin-1-yl]-(1H-pyrrol-2-yl)methanone.
| Compound Name | [(2R,3R)-3-(2-methoxyethoxy)-2-(pyridin-4-ylmethyl)pyrrolidin-1-yl]-(1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 133141846 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | [(2R,3R)-3-(2-methoxyethoxy)-2-(pyridin-4-ylmethyl)pyrrolidin-1-yl]-(1H-pyrrol-2-yl)methanone |
| SMILES | COCCO[C@@H]1CCN(C(=O)c2ccc[nH]2)[C@@H]1Cc1ccncc1 |
| InChI | InChI=1S/C18H23N3O3/c1-23-11-12-24-17-6-10-21(18(22)15-3-2-7-20-15)16(17)13-14-4-8-19-9-5-14/h2-5,7-9,16-17,20H,6,10-13H2,1H3/t16-,17-/m1/s1 |
| InChIKey | VOBKCRPUCMXTNR-IAGOWNOFSA-N |
| XLogP | 1.90 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|