C17H23N3O3S — CID 97470727
[(2S,3S)-3-(2-methoxyethoxy)-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]-thiophen-2-ylmethanone (PubChem CID 97470727) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is [(2S,3S)-3-(2-methoxyethoxy)-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [(2S,3S)-3-(2-methoxyethoxy)-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 97470727 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | [(2S,3S)-3-(2-methoxyethoxy)-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]-thiophen-2-ylmethanone |
| SMILES | COCCO[C@H]1CCN(C(=O)c2cccs2)[C@H]1Cc1cnn(C)c1 |
| InChI | InChI=1S/C17H23N3O3S/c1-19-12-13(11-18-19)10-14-15(23-8-7-22-2)5-6-20(14)17(21)16-4-3-9-24-16/h3-4,9,11-12,14-15H,5-8,10H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | BKINBVVPHRTOFO-GJZGRUSLSA-N |
| XLogP | 1.97 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|