C17H25N3O2S — CID 97470279
4-[[(2S,3R)-3-(2-methoxyethoxy)-1-(thiophen-3-ylmethyl)pyrrolidin-2-yl]methyl]-1-methylpyrazole (PubChem CID 97470279) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is 4-[[(2S,3R)-3-(2-methoxyethoxy)-1-(thiophen-3-ylmethyl)pyrrolidin-2-yl]methyl]-1-methylpyrazole.
| Compound Name | 4-[[(2S,3R)-3-(2-methoxyethoxy)-1-(thiophen-3-ylmethyl)pyrrolidin-2-yl]methyl]-1-methylpyrazole |
|---|---|
| PubChem CID | 97470279 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 4-[[(2S,3R)-3-(2-methoxyethoxy)-1-(thiophen-3-ylmethyl)pyrrolidin-2-yl]methyl]-1-methylpyrazole |
| SMILES | COCCO[C@@H]1CCN(Cc2ccsc2)[C@H]1Cc1cnn(C)c1 |
| InChI | InChI=1S/C17H25N3O2S/c1-19-11-15(10-18-19)9-16-17(22-7-6-21-2)3-5-20(16)12-14-4-8-23-13-14/h4,8,10-11,13,16-17H,3,5-7,9,12H2,1-2H3/t16-,17+/m0/s1 |
| InChIKey | UWGRCJXPKNBUTO-DLBZAZTESA-N |
| XLogP | 2.33 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|