C19H26FN3O2 — CID 124821987
4-[[(2R,3R)-1-[(4-fluorophenyl)methyl]-3-(2-methoxyethoxy)pyrrolidin-2-yl]methyl]-1-methylpyrazole (PubChem CID 124821987) has the molecular formula C19H26FN3O2 and a molecular weight of 347.43 g/mol. Its IUPAC name is 4-[[(2R,3R)-1-[(4-fluorophenyl)methyl]-3-(2-methoxyethoxy)pyrrolidin-2-yl]methyl]-1-methylpyrazole.
| Compound Name | 4-[[(2R,3R)-1-[(4-fluorophenyl)methyl]-3-(2-methoxyethoxy)pyrrolidin-2-yl]methyl]-1-methylpyrazole |
|---|---|
| PubChem CID | 124821987 |
| Molecular Formula | C19H26FN3O2 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 4-[[(2R,3R)-1-[(4-fluorophenyl)methyl]-3-(2-methoxyethoxy)pyrrolidin-2-yl]methyl]-1-methylpyrazole |
| SMILES | COCCO[C@@H]1CCN(Cc2ccc(F)cc2)[C@@H]1Cc1cnn(C)c1 |
| InChI | InChI=1S/C19H26FN3O2/c1-22-13-16(12-21-22)11-18-19(25-10-9-24-2)7-8-23(18)14-15-3-5-17(20)6-4-15/h3-6,12-13,18-19H,7-11,14H2,1-2H3/t18-,19-/m1/s1 |
| InChIKey | ZDEPGXSWVALWGB-RTBURBONSA-N |
| XLogP | 2.41 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|