C21H26N2O4 — CID 131697074
1-[2-[(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-2-oxoethyl]pyridin-2-one (PubChem CID 131697074) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 1-[2-[(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-2-oxoethyl]pyridin-2-one.
| Compound Name | 1-[2-[(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-2-oxoethyl]pyridin-2-one |
|---|---|
| PubChem CID | 131697074 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 1-[2-[(2S,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]-2-oxoethyl]pyridin-2-one |
| SMILES | COCCO[C@@H]1CCN(C(=O)Cn2ccccc2=O)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C21H26N2O4/c1-26-13-14-27-19-10-12-23(18(19)15-17-7-3-2-4-8-17)21(25)16-22-11-6-5-9-20(22)24/h2-9,11,18-19H,10,12-16H2,1H3/t18-,19+/m0/s1 |
| InChIKey | QZUNVRJQBIHXBJ-RBUKOAKNSA-N |
| XLogP | 1.72 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|