C17H25N3O3 — CID 125236994
(2R,3R)-N-cyclopropyl-3-(2-methoxyethoxy)-2-(pyridin-3-ylmethyl)pyrrolidine-1-carboxamide (PubChem CID 125236994) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is (2R,3R)-N-cyclopropyl-3-(2-methoxyethoxy)-2-(pyridin-3-ylmethyl)pyrrolidine-1-carboxamide.
| Compound Name | (2R,3R)-N-cyclopropyl-3-(2-methoxyethoxy)-2-(pyridin-3-ylmethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 125236994 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | (2R,3R)-N-cyclopropyl-3-(2-methoxyethoxy)-2-(pyridin-3-ylmethyl)pyrrolidine-1-carboxamide |
| SMILES | COCCO[C@@H]1CCN(C(=O)NC2CC2)[C@@H]1Cc1cccnc1 |
| InChI | InChI=1S/C17H25N3O3/c1-22-9-10-23-16-6-8-20(17(21)19-14-4-5-14)15(16)11-13-3-2-7-18-12-13/h2-3,7,12,14-16H,4-6,8-11H2,1H3,(H,19,21)/t15-,16-/m1/s1 |
| InChIKey | TZZQYRZPHBJGCH-HZPDHXFCSA-N |
| XLogP | 1.60 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|