C18H24N4O3 — CID 124795341
4-methoxy-6-[(2R,3R)-3-(2-methoxyethoxy)-2-(pyridin-3-ylmethyl)pyrrolidin-1-yl]pyrimidine (PubChem CID 124795341) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 4-methoxy-6-[(2R,3R)-3-(2-methoxyethoxy)-2-(pyridin-3-ylmethyl)pyrrolidin-1-yl]pyrimidine.
| Compound Name | 4-methoxy-6-[(2R,3R)-3-(2-methoxyethoxy)-2-(pyridin-3-ylmethyl)pyrrolidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 124795341 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 4-methoxy-6-[(2R,3R)-3-(2-methoxyethoxy)-2-(pyridin-3-ylmethyl)pyrrolidin-1-yl]pyrimidine |
| SMILES | COCCO[C@@H]1CCN(c2cc(OC)ncn2)[C@@H]1Cc1cccnc1 |
| InChI | InChI=1S/C18H24N4O3/c1-23-8-9-25-16-5-7-22(17-11-18(24-2)21-13-20-17)15(16)10-14-4-3-6-19-12-14/h3-4,6,11-13,15-16H,5,7-10H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | IIFFSMASLOMVBY-HZPDHXFCSA-N |
| XLogP | 1.73 |
| TPSA | 69.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|