C17H21N5O — CID 125188127
(3aR,6aR)-4-(6-methoxypyrimidin-4-yl)-1-(pyridin-3-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole (PubChem CID 125188127) has the molecular formula C17H21N5O and a molecular weight of 311.39 g/mol. Its IUPAC name is (3aR,6aR)-4-(6-methoxypyrimidin-4-yl)-1-(pyridin-3-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole.
| Compound Name | (3aR,6aR)-4-(6-methoxypyrimidin-4-yl)-1-(pyridin-3-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 125188127 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | (3aR,6aR)-4-(6-methoxypyrimidin-4-yl)-1-(pyridin-3-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole |
| SMILES | COc1cc(N2CC[C@@H]3[C@H]2CCN3Cc2cccnc2)ncn1 |
| InChI | InChI=1S/C17H21N5O/c1-23-17-9-16(19-12-20-17)22-8-5-14-15(22)4-7-21(14)11-13-3-2-6-18-10-13/h2-3,6,9-10,12,14-15H,4-5,7-8,11H2,1H3/t14-,15-/m1/s1 |
| InChIKey | KXXBRJYQNQRBID-HUUCEWRRSA-N |
| XLogP | 1.73 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |