C16H24N2O4S — CID 97470594
3-[[(2S,3S)-1-cyclopropylsulfonyl-3-(2-methoxyethoxy)pyrrolidin-2-yl]methyl]pyridine (PubChem CID 97470594) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is 3-[[(2S,3S)-1-cyclopropylsulfonyl-3-(2-methoxyethoxy)pyrrolidin-2-yl]methyl]pyridine.
| Compound Name | 3-[[(2S,3S)-1-cyclopropylsulfonyl-3-(2-methoxyethoxy)pyrrolidin-2-yl]methyl]pyridine |
|---|---|
| PubChem CID | 97470594 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 3-[[(2S,3S)-1-cyclopropylsulfonyl-3-(2-methoxyethoxy)pyrrolidin-2-yl]methyl]pyridine |
| SMILES | COCCO[C@H]1CCN(S(=O)(=O)C2CC2)[C@H]1Cc1cccnc1 |
| InChI | InChI=1S/C16H24N2O4S/c1-21-9-10-22-16-6-8-18(23(19,20)14-4-5-14)15(16)11-13-3-2-7-17-12-13/h2-3,7,12,14-16H,4-6,8-11H2,1H3/t15-,16-/m0/s1 |
| InChIKey | VFLYEAZBIIGCFR-HOTGVXAUSA-N |
| XLogP | 1.22 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|