C18H28N2O3 — CID 97470591
3-[[(2S,3S)-3-(2-methoxyethoxy)-1-[[(3R)-oxolan-3-yl]methyl]pyrrolidin-2-yl]methyl]pyridine (PubChem CID 97470591) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is 3-[[(2S,3S)-3-(2-methoxyethoxy)-1-[[(3R)-oxolan-3-yl]methyl]pyrrolidin-2-yl]methyl]pyridine.
| Compound Name | 3-[[(2S,3S)-3-(2-methoxyethoxy)-1-[[(3R)-oxolan-3-yl]methyl]pyrrolidin-2-yl]methyl]pyridine |
|---|---|
| PubChem CID | 97470591 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 3-[[(2S,3S)-3-(2-methoxyethoxy)-1-[[(3R)-oxolan-3-yl]methyl]pyrrolidin-2-yl]methyl]pyridine |
| SMILES | COCCO[C@H]1CCN(C[C@H]2CCOC2)[C@H]1Cc1cccnc1 |
| InChI | InChI=1S/C18H28N2O3/c1-21-9-10-23-18-4-7-20(13-16-5-8-22-14-16)17(18)11-15-3-2-6-19-12-15/h2-3,6,12,16-18H,4-5,7-11,13-14H2,1H3/t16-,17+,18+/m1/s1 |
| InChIKey | HQDNVSKZXYPMRE-SQNIBIBYSA-N |
| XLogP | 1.77 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|