C18H26N2O2 — CID 97470609
3-[[(2S,3S)-1-(oxan-4-yl)-3-prop-2-enoxypyrrolidin-2-yl]methyl]pyridine (PubChem CID 97470609) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 3-[[(2S,3S)-1-(oxan-4-yl)-3-prop-2-enoxypyrrolidin-2-yl]methyl]pyridine.
| Compound Name | 3-[[(2S,3S)-1-(oxan-4-yl)-3-prop-2-enoxypyrrolidin-2-yl]methyl]pyridine |
|---|---|
| PubChem CID | 97470609 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 3-[[(2S,3S)-1-(oxan-4-yl)-3-prop-2-enoxypyrrolidin-2-yl]methyl]pyridine |
| SMILES | C=CCO[C@H]1CCN(C2CCOCC2)[C@H]1Cc1cccnc1 |
| InChI | InChI=1S/C18H26N2O2/c1-2-10-22-18-5-9-20(16-6-11-21-12-7-16)17(18)13-15-4-3-8-19-14-15/h2-4,8,14,16-18H,1,5-7,9-13H2/t17-,18-/m0/s1 |
| InChIKey | IRRJIHWZZOKQEX-ROUUACIJSA-N |
| XLogP | 2.45 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|