C18H24N4O — CID 97470219
3-[[(2S,3R)-1-[(1-methylimidazol-2-yl)methyl]-3-prop-2-enoxypyrrolidin-2-yl]methyl]pyridine (PubChem CID 97470219) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is 3-[[(2S,3R)-1-[(1-methylimidazol-2-yl)methyl]-3-prop-2-enoxypyrrolidin-2-yl]methyl]pyridine.
| Compound Name | 3-[[(2S,3R)-1-[(1-methylimidazol-2-yl)methyl]-3-prop-2-enoxypyrrolidin-2-yl]methyl]pyridine |
|---|---|
| PubChem CID | 97470219 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 3-[[(2S,3R)-1-[(1-methylimidazol-2-yl)methyl]-3-prop-2-enoxypyrrolidin-2-yl]methyl]pyridine |
| SMILES | C=CCO[C@@H]1CCN(Cc2nccn2C)[C@H]1Cc1cccnc1 |
| InChI | InChI=1S/C18H24N4O/c1-3-11-23-17-6-9-22(14-18-20-8-10-21(18)2)16(17)12-15-5-4-7-19-13-15/h3-5,7-8,10,13,16-17H,1,6,9,11-12,14H2,2H3/t16-,17+/m0/s1 |
| InChIKey | FLQCKWUENVOADQ-DLBZAZTESA-N |
| XLogP | 2.20 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|