C19H27N3O2 — CID 124816993
2-[[(2R,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]methyl]-1-methylimidazole (PubChem CID 124816993) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 2-[[(2R,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]methyl]-1-methylimidazole.
| Compound Name | 2-[[(2R,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]methyl]-1-methylimidazole |
|---|---|
| PubChem CID | 124816993 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 2-[[(2R,3R)-2-benzyl-3-(2-methoxyethoxy)pyrrolidin-1-yl]methyl]-1-methylimidazole |
| SMILES | COCCO[C@@H]1CCN(Cc2nccn2C)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C19H27N3O2/c1-21-11-9-20-19(21)15-22-10-8-18(24-13-12-23-2)17(22)14-16-6-4-3-5-7-16/h3-7,9,11,17-18H,8,10,12-15H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | KAQSVZHDAMQWHK-QZTJIDSGSA-N |
| XLogP | 2.27 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|