C20H28N2O3 — CID 97470831
4-[[(2S,3S)-1-[(4,5-dimethylfuran-2-yl)methyl]-3-(2-methoxyethoxy)pyrrolidin-2-yl]methyl]pyridine (PubChem CID 97470831) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is 4-[[(2S,3S)-1-[(4,5-dimethylfuran-2-yl)methyl]-3-(2-methoxyethoxy)pyrrolidin-2-yl]methyl]pyridine.
| Compound Name | 4-[[(2S,3S)-1-[(4,5-dimethylfuran-2-yl)methyl]-3-(2-methoxyethoxy)pyrrolidin-2-yl]methyl]pyridine |
|---|---|
| PubChem CID | 97470831 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 4-[[(2S,3S)-1-[(4,5-dimethylfuran-2-yl)methyl]-3-(2-methoxyethoxy)pyrrolidin-2-yl]methyl]pyridine |
| SMILES | COCCO[C@H]1CCN(Cc2cc(C)c(C)o2)[C@H]1Cc1ccncc1 |
| InChI | InChI=1S/C20H28N2O3/c1-15-12-18(25-16(15)2)14-22-9-6-20(24-11-10-23-3)19(22)13-17-4-7-21-8-5-17/h4-5,7-8,12,19-20H,6,9-11,13-14H2,1-3H3/t19-,20-/m0/s1 |
| InChIKey | MBZLPTIIAZRAKV-PMACEKPBSA-N |
| XLogP | 3.14 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|